C16H16N2O3 — CID 9061879
[(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] quinoline-8-carboxylate (PubChem CID 9061879) has the molecular formula C16H16N2O3 and a molecular weight of 284.32 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] quinoline-8-carboxylate.
| Compound Name | [(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] quinoline-8-carboxylate |
|---|---|
| PubChem CID | 9061879 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | [(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] quinoline-8-carboxylate |
| SMILES | C=CCNC(=O)[C@@H](C)OC(=O)c1cccc2cccnc12 |
| InChI | InChI=1S/C16H16N2O3/c1-3-9-18-15(19)11(2)21-16(20)13-8-4-6-12-7-5-10-17-14(12)13/h3-8,10-11H,1,9H2,2H3,(H,18,19)/t11-/m1/s1 |
| InChIKey | YOBVMJCAVCFXTQ-LLVKDONJSA-N |
| XLogP | 2.08 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|