C19H30F2N2O4 — CID 78045888
2-fluoro-N-[2-[(2-fluoro-8-hydroxyoct-2-enoyl)amino]cyclopropyl]-8-hydroxyoct-2-enamide (PubChem CID 78045888) has the molecular formula C19H30F2N2O4 and a molecular weight of 388.46 g/mol. Its IUPAC name is 2-fluoro-N-[2-[(2-fluoro-8-hydroxyoct-2-enoyl)amino]cyclopropyl]-8-hydroxyoct-2-enamide.
| Compound Name | 2-fluoro-N-[2-[(2-fluoro-8-hydroxyoct-2-enoyl)amino]cyclopropyl]-8-hydroxyoct-2-enamide |
|---|---|
| PubChem CID | 78045888 |
| Molecular Formula | C19H30F2N2O4 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 2-fluoro-N-[2-[(2-fluoro-8-hydroxyoct-2-enoyl)amino]cyclopropyl]-8-hydroxyoct-2-enamide |
| SMILES | O=C(NC1CC1NC(=O)C(F)=CCCCCCO)C(F)=CCCCCCO |
| InChI | InChI=1S/C19H30F2N2O4/c20-14(9-5-1-3-7-11-24)18(26)22-16-13-17(16)23-19(27)15(21)10-6-2-4-8-12-25/h9-10,16-17,24-25H,1-8,11-13H2,(H,22,26)(H,23,27) |
| InChIKey | NYAGVGDNAUDFMN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|