C25H44N2O4 — CID 123565644
11-hydroxy-N-[(1R,2R)-2-(11-hydroxyundec-2-enoylamino)cyclopropyl]undec-2-enamide (PubChem CID 123565644) has the molecular formula C25H44N2O4 and a molecular weight of 436.64 g/mol. Its IUPAC name is 11-hydroxy-N-[(1R,2R)-2-(11-hydroxyundec-2-enoylamino)cyclopropyl]undec-2-enamide.
| Compound Name | 11-hydroxy-N-[(1R,2R)-2-(11-hydroxyundec-2-enoylamino)cyclopropyl]undec-2-enamide |
|---|---|
| PubChem CID | 123565644 |
| Molecular Formula | C25H44N2O4 |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.33 |
| IUPAC Name | 11-hydroxy-N-[(1R,2R)-2-(11-hydroxyundec-2-enoylamino)cyclopropyl]undec-2-enamide |
| SMILES | O=C(C=CCCCCCCCCO)N[C@@H]1C[C@H]1NC(=O)C=CCCCCCCCCO |
| InChI | InChI=1S/C25H44N2O4/c28-19-15-11-7-3-1-5-9-13-17-24(30)26-22-21-23(22)27-25(31)18-14-10-6-2-4-8-12-16-20-29/h13-14,17-18,22-23,28-29H,1-12,15-16,19-21H2,(H,26,30)(H,27,31)/t22-,23-/m1/s1 |
| InChIKey | NXWKPXLFEZDYIZ-DHIUTWEWSA-N |
| XLogP | 3.92 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|