C20H38N2O4 — CID 19606629
(E)-N,N'-bis(4-hydroxybutyl)dodec-2-enediamide (PubChem CID 19606629) has the molecular formula C20H38N2O4 and a molecular weight of 370.53 g/mol. Its IUPAC name is (E)-N,N'-bis(4-hydroxybutyl)dodec-2-enediamide.
| Compound Name | (E)-N,N'-bis(4-hydroxybutyl)dodec-2-enediamide |
|---|---|
| PubChem CID | 19606629 |
| Molecular Formula | C20H38N2O4 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.28 |
| IUPAC Name | (E)-N,N'-bis(4-hydroxybutyl)dodec-2-enediamide |
| SMILES | O=C(/C=C/CCCCCCCCC(=O)NCCCCO)NCCCCO |
| InChI | InChI=1S/C20H38N2O4/c23-17-11-9-15-21-19(25)13-7-5-3-1-2-4-6-8-14-20(26)22-16-10-12-18-24/h7,13,23-24H,1-6,8-12,14-18H2,(H,21,25)(H,22,26)/b13-7+ |
| InChIKey | AMGGSZDSKFKFHI-NTUHNPAUSA-N |
| XLogP | 2.44 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|