C18H34N2O4 — CID 54010155
N,N'-bis(3-hydroxypropyl)dodec-2-enediamide (PubChem CID 54010155) has the molecular formula C18H34N2O4 and a molecular weight of 342.48 g/mol. Its IUPAC name is N,N'-bis(3-hydroxypropyl)dodec-2-enediamide.
| Compound Name | N,N'-bis(3-hydroxypropyl)dodec-2-enediamide |
|---|---|
| PubChem CID | 54010155 |
| Molecular Formula | C18H34N2O4 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.25 |
| IUPAC Name | N,N'-bis(3-hydroxypropyl)dodec-2-enediamide |
| SMILES | O=C(C=CCCCCCCCCC(=O)NCCCO)NCCCO |
| InChI | InChI=1S/C18H34N2O4/c21-15-9-13-19-17(23)11-7-5-3-1-2-4-6-8-12-18(24)20-14-10-16-22/h7,11,21-22H,1-6,8-10,12-16H2,(H,19,23)(H,20,24) |
| InChIKey | KRTIHDFLDMBKRS-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|