C23H28F3N — CID 78047515
2-methyl-6-(4-methylphenyl)-N-[[4-(trifluoromethyl)phenyl]methyl]hept-2-en-4-amine (PubChem CID 78047515) has the molecular formula C23H28F3N and a molecular weight of 375.48 g/mol. Its IUPAC name is 2-methyl-6-(4-methylphenyl)-N-[[4-(trifluoromethyl)phenyl]methyl]hept-2-en-4-amine.
| Compound Name | 2-methyl-6-(4-methylphenyl)-N-[[4-(trifluoromethyl)phenyl]methyl]hept-2-en-4-amine |
|---|---|
| PubChem CID | 78047515 |
| Molecular Formula | C23H28F3N |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 2-methyl-6-(4-methylphenyl)-N-[[4-(trifluoromethyl)phenyl]methyl]hept-2-en-4-amine |
| SMILES | CC(C)=CC(CC(C)c1ccc(C)cc1)NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H28F3N/c1-16(2)13-22(14-18(4)20-9-5-17(3)6-10-20)27-15-19-7-11-21(12-8-19)23(24,25)26/h5-13,18,22,27H,14-15H2,1-4H3 |
| InChIKey | QKUNTPYAVALKRC-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|