C19H31ClN- — CID 71532598
(6S)-2-methyl-6-(4-methylphenyl)-N-(2-methylpropyl)hept-2-en-4-amine chloride (PubChem CID 71532598) has the molecular formula C19H31ClN- and a molecular weight of 308.92 g/mol. Its IUPAC name is (6S)-2-methyl-6-(4-methylphenyl)-N-(2-methylpropyl)hept-2-en-4-amine chloride.
| Compound Name | (6S)-2-methyl-6-(4-methylphenyl)-N-(2-methylpropyl)hept-2-en-4-amine chloride |
|---|---|
| PubChem CID | 71532598 |
| Molecular Formula | C19H31ClN- |
| Molecular Weight | 308.92 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | (6S)-2-methyl-6-(4-methylphenyl)-N-(2-methylpropyl)hept-2-en-4-amine chloride |
| SMILES | CC(C)=CC(C[C@H](C)c1ccc(C)cc1)NCC(C)C.[Cl-] |
| InChI | InChI=1S/C19H31N.ClH/c1-14(2)11-19(20-13-15(3)4)12-17(6)18-9-7-16(5)8-10-18;/h7-11,15,17,19-20H,12-13H2,1-6H3;1H/p-1/t17-,19?;/m0./s1 |
| InChIKey | FSCQKZNYJHBPAE-XRZIKPEHSA-M |
| XLogP | 2.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.92 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|