C20H31N — CID 78047516
1-[2-methyl-6-(4-methylphenyl)hept-2-en-4-yl]piperidine (PubChem CID 78047516) has the molecular formula C20H31N and a molecular weight of 285.48 g/mol. Its IUPAC name is 1-[2-methyl-6-(4-methylphenyl)hept-2-en-4-yl]piperidine.
| Compound Name | 1-[2-methyl-6-(4-methylphenyl)hept-2-en-4-yl]piperidine |
|---|---|
| PubChem CID | 78047516 |
| Molecular Formula | C20H31N |
| Molecular Weight | 285.48 g/mol |
| Exact Mass | 285.25 |
| IUPAC Name | 1-[2-methyl-6-(4-methylphenyl)hept-2-en-4-yl]piperidine |
| SMILES | CC(C)=CC(CC(C)c1ccc(C)cc1)N1CCCCC1 |
| InChI | InChI=1S/C20H31N/c1-16(2)14-20(21-12-6-5-7-13-21)15-18(4)19-10-8-17(3)9-11-19/h8-11,14,18,20H,5-7,12-13,15H2,1-4H3 |
| InChIKey | YFQKABSHKQCJKW-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.48 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|