C16H18O7 — CID 78051988
4-[5-(6-ethoxy-3,6-dioxohex-1-enyl)furan-2-yl]-4-oxobutanoic acid (PubChem CID 78051988) has the molecular formula C16H18O7 and a molecular weight of 322.31 g/mol. Its IUPAC name is 4-[5-(6-ethoxy-3,6-dioxohex-1-enyl)furan-2-yl]-4-oxobutanoic acid.
| Compound Name | 4-[5-(6-ethoxy-3,6-dioxohex-1-enyl)furan-2-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 78051988 |
| Molecular Formula | C16H18O7 |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 4-[5-(6-ethoxy-3,6-dioxohex-1-enyl)furan-2-yl]-4-oxobutanoic acid |
| SMILES | CCOC(=O)CCC(=O)C=Cc1ccc(C(=O)CCC(=O)O)o1 |
| InChI | InChI=1S/C16H18O7/c1-2-22-16(21)10-4-11(17)3-5-12-6-8-14(23-12)13(18)7-9-15(19)20/h3,5-6,8H,2,4,7,9-10H2,1H3,(H,19,20) |
| InChIKey | PTIHUOFQYJSSQU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|