C17H14BrN3O2S — CID 78057685
1-phenylethyl N-[4-(4-bromophenyl)-1,2,5-thiadiazol-3-yl]carbamate (PubChem CID 78057685) has the molecular formula C17H14BrN3O2S and a molecular weight of 404.29 g/mol. Its IUPAC name is 1-phenylethyl N-[4-(4-bromophenyl)-1,2,5-thiadiazol-3-yl]carbamate.
| Compound Name | 1-phenylethyl N-[4-(4-bromophenyl)-1,2,5-thiadiazol-3-yl]carbamate |
|---|---|
| PubChem CID | 78057685 |
| Molecular Formula | C17H14BrN3O2S |
| Molecular Weight | 404.29 g/mol |
| Exact Mass | 403.00 |
| IUPAC Name | 1-phenylethyl N-[4-(4-bromophenyl)-1,2,5-thiadiazol-3-yl]carbamate |
| SMILES | CC(OC(=O)Nc1nsnc1-c1ccc(Br)cc1)c1ccccc1 |
| InChI | InChI=1S/C17H14BrN3O2S/c1-11(12-5-3-2-4-6-12)23-17(22)19-16-15(20-24-21-16)13-7-9-14(18)10-8-13/h2-11H,1H3,(H,19,21,22) |
| InChIKey | BVCZEKZNLZWZAP-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.29 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |