C24H33N5O7 — CID 78058211
2-(propoxymethyl)-5-[6-[1-(3,4,5-trimethoxyphenyl)ethylamino]purin-9-yl]oxolane-3,4-diol (PubChem CID 78058211) has the molecular formula C24H33N5O7 and a molecular weight of 503.56 g/mol. Its IUPAC name is 2-(propoxymethyl)-5-[6-[1-(3,4,5-trimethoxyphenyl)ethylamino]purin-9-yl]oxolane-3,4-diol.
| Compound Name | 2-(propoxymethyl)-5-[6-[1-(3,4,5-trimethoxyphenyl)ethylamino]purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 78058211 |
| Molecular Formula | C24H33N5O7 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | 2-(propoxymethyl)-5-[6-[1-(3,4,5-trimethoxyphenyl)ethylamino]purin-9-yl]oxolane-3,4-diol |
| SMILES | CCCOCC1OC(n2cnc3c(NC(C)c4cc(OC)c(OC)c(OC)c4)ncnc32)C(O)C1O |
| InChI | InChI=1S/C24H33N5O7/c1-6-7-35-10-17-19(30)20(31)24(36-17)29-12-27-18-22(25-11-26-23(18)29)28-13(2)14-8-15(32-3)21(34-5)16(9-14)33-4/h8-9,11-13,17,19-20,24,30-31H,6-7,10H2,1-5H3,(H,25,26,28) |
| InChIKey | HIHXGFKCUTYPBF-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 142.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|