C13H10N4O4S — CID 7807322
1-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]-3-prop-2-enylimidazolidine-2,4,5-trione (PubChem CID 7807322) has the molecular formula C13H10N4O4S and a molecular weight of 318.31 g/mol. Its IUPAC name is 1-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]-3-prop-2-enylimidazolidine-2,4,5-trione.
| Compound Name | 1-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]-3-prop-2-enylimidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 7807322 |
| Molecular Formula | C13H10N4O4S |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 1-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]-3-prop-2-enylimidazolidine-2,4,5-trione |
| SMILES | C=CCN1C(=O)C(=O)N(Cc2cc(=O)n3ccsc3n2)C1=O |
| InChI | InChI=1S/C13H10N4O4S/c1-2-3-16-10(19)11(20)17(13(16)21)7-8-6-9(18)15-4-5-22-12(15)14-8/h2,4-6H,1,3,7H2 |
| InChIKey | CMIFMTGFURRHTG-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 92.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|