C11H10N4O3S — CID 8014711
1-methyl-3-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]imidazolidine-2,4-dione (PubChem CID 8014711) has the molecular formula C11H10N4O3S and a molecular weight of 278.29 g/mol. Its IUPAC name is 1-methyl-3-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 1-methyl-3-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 8014711 |
| Molecular Formula | C11H10N4O3S |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 1-methyl-3-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]imidazolidine-2,4-dione |
| SMILES | CN1CC(=O)N(Cc2cc(=O)n3ccsc3n2)C1=O |
| InChI | InChI=1S/C11H10N4O3S/c1-13-6-9(17)15(11(13)18)5-7-4-8(16)14-2-3-19-10(14)12-7/h2-4H,5-6H2,1H3 |
| InChIKey | DMYCJQPCBOZURQ-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 74.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|