C23H17F2N3O6 — CID 78097461
3,5-bis[(4-fluoro-3-nitrophenyl)methylidene]-1-prop-2-enoylazepan-4-one (PubChem CID 78097461) has the molecular formula C23H17F2N3O6 and a molecular weight of 469.40 g/mol. Its IUPAC name is 3,5-bis[(4-fluoro-3-nitrophenyl)methylidene]-1-prop-2-enoylazepan-4-one.
| Compound Name | 3,5-bis[(4-fluoro-3-nitrophenyl)methylidene]-1-prop-2-enoylazepan-4-one |
|---|---|
| PubChem CID | 78097461 |
| Molecular Formula | C23H17F2N3O6 |
| Molecular Weight | 469.40 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | 3,5-bis[(4-fluoro-3-nitrophenyl)methylidene]-1-prop-2-enoylazepan-4-one |
| SMILES | C=CC(=O)N1CCC(=Cc2ccc(F)c([N+](=O)[O-])c2)C(=O)C(=Cc2ccc(F)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C23H17F2N3O6/c1-2-22(29)26-8-7-16(9-14-3-5-18(24)20(11-14)27(31)32)23(30)17(13-26)10-15-4-6-19(25)21(12-15)28(33)34/h2-6,9-12H,1,7-8,13H2 |
| InChIKey | SCKXBVLYWLLALY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|