C24H17F2N3O6 — CID 155534324
(3E,5E)-1-but-3-ynoyl-3,5-bis[(4-fluoro-3-nitrophenyl)methylidene]azepan-4-one (PubChem CID 155534324) has the molecular formula C24H17F2N3O6 and a molecular weight of 481.41 g/mol. Its IUPAC name is (3E,5E)-1-but-3-ynoyl-3,5-bis[(4-fluoro-3-nitrophenyl)methylidene]azepan-4-one.
| Compound Name | (3E,5E)-1-but-3-ynoyl-3,5-bis[(4-fluoro-3-nitrophenyl)methylidene]azepan-4-one |
|---|---|
| PubChem CID | 155534324 |
| Molecular Formula | C24H17F2N3O6 |
| Molecular Weight | 481.41 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | (3E,5E)-1-but-3-ynoyl-3,5-bis[(4-fluoro-3-nitrophenyl)methylidene]azepan-4-one |
| SMILES | C#CCC(=O)N1CC/C(=C\c2ccc(F)c([N+](=O)[O-])c2)C(=O)/C(=C/c2ccc(F)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C24H17F2N3O6/c1-2-3-23(30)27-9-8-17(10-15-4-6-19(25)21(12-15)28(32)33)24(31)18(14-27)11-16-5-7-20(26)22(13-16)29(34)35/h1,4-7,10-13H,3,8-9,14H2/b17-10+,18-11+ |
| InChIKey | YZXJGQIHLWQTES-ODPUSEOTSA-N |
| XLogP | 4.07 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|