C23H17F2N3O4 — CID 130438744
(3Z,5Z)-3,5-bis[(4-fluoro-3-nitrosophenyl)methylidene]-1-prop-2-enoylazepan-4-one (PubChem CID 130438744) has the molecular formula C23H17F2N3O4 and a molecular weight of 437.40 g/mol. Its IUPAC name is (3Z,5Z)-3,5-bis[(4-fluoro-3-nitrosophenyl)methylidene]-1-prop-2-enoylazepan-4-one.
| Compound Name | (3Z,5Z)-3,5-bis[(4-fluoro-3-nitrosophenyl)methylidene]-1-prop-2-enoylazepan-4-one |
|---|---|
| PubChem CID | 130438744 |
| Molecular Formula | C23H17F2N3O4 |
| Molecular Weight | 437.40 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | (3Z,5Z)-3,5-bis[(4-fluoro-3-nitrosophenyl)methylidene]-1-prop-2-enoylazepan-4-one |
| SMILES | C=CC(=O)N1CC/C(=C/c2ccc(F)c(N=O)c2)C(=O)/C(=C\c2ccc(F)c(N=O)c2)C1 |
| InChI | InChI=1S/C23H17F2N3O4/c1-2-22(29)28-8-7-16(9-14-3-5-18(24)20(11-14)26-31)23(30)17(13-28)10-15-4-6-19(25)21(12-15)27-32/h2-6,9-12H,1,7-8,13H2/b16-9-,17-10- |
| InChIKey | UWBCTRZFPCBLNM-CQRYCMKKSA-N |
| XLogP | 5.22 |
| TPSA | 96.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.40 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|