C23H19F2N3O4+2 — CID 153430764
[2-fluoro-5-[(Z)-[(5Z)-5-[(4-fluoro-3-oxoazaniumylphenyl)methylidene]-4-oxo-1-prop-2-enoylazepan-3-ylidene]methyl]phenyl]-oxoazanium (PubChem CID 153430764) has the molecular formula C23H19F2N3O4+2 and a molecular weight of 439.42 g/mol. Its IUPAC name is [2-fluoro-5-[(Z)-[(5Z)-5-[(4-fluoro-3-oxoazaniumylphenyl)methylidene]-4-oxo-1-prop-2-enoylazepan-3-ylidene]methyl]phenyl]-oxoazanium.
| Compound Name | [2-fluoro-5-[(Z)-[(5Z)-5-[(4-fluoro-3-oxoazaniumylphenyl)methylidene]-4-oxo-1-prop-2-enoylazepan-3-ylidene]methyl]phenyl]-oxoazanium |
|---|---|
| PubChem CID | 153430764 |
| Molecular Formula | C23H19F2N3O4+2 |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | [2-fluoro-5-[(Z)-[(5Z)-5-[(4-fluoro-3-oxoazaniumylphenyl)methylidene]-4-oxo-1-prop-2-enoylazepan-3-ylidene]methyl]phenyl]-oxoazanium |
| SMILES | C=CC(=O)N1CC/C(=C/c2ccc(F)c([NH+]=O)c2)C(=O)/C(=C\c2ccc(F)c([NH+]=O)c2)C1 |
| InChI | InChI=1S/C23H17F2N3O4/c1-2-22(29)28-8-7-16(9-14-3-5-18(24)20(11-14)26-31)23(30)17(13-28)10-15-4-6-19(25)21(12-15)27-32/h2-6,9-12H,1,7-8,13H2/p+2/b16-9-,17-10- |
| InChIKey | UWBCTRZFPCBLNM-CQRYCMKKSA-P |
| XLogP | 1.38 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|