C33H32F3NO7 — CID 78102524
N-[5-(3,4-dimethoxyphenyl)-2-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]-3-oxo-1-[3-(trifluoromethyl)phenyl]pent-4-enyl]acetamide (PubChem CID 78102524) has the molecular formula C33H32F3NO7 and a molecular weight of 611.61 g/mol. Its IUPAC name is N-[5-(3,4-dimethoxyphenyl)-2-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]-3-oxo-1-[3-(trifluoromethyl)phenyl]pent-4-enyl]acetamide.
| Compound Name | N-[5-(3,4-dimethoxyphenyl)-2-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]-3-oxo-1-[3-(trifluoromethyl)phenyl]pent-4-enyl]acetamide |
|---|---|
| PubChem CID | 78102524 |
| Molecular Formula | C33H32F3NO7 |
| Molecular Weight | 611.61 g/mol |
| Exact Mass | 611.21 |
| IUPAC Name | N-[5-(3,4-dimethoxyphenyl)-2-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]-3-oxo-1-[3-(trifluoromethyl)phenyl]pent-4-enyl]acetamide |
| SMILES | COc1ccc(C=CC(=O)C(C(=O)C=Cc2ccc(OC)c(OC)c2)C(NC(C)=O)c2cccc(C(F)(F)F)c2)cc1OC |
| InChI | InChI=1S/C33H32F3NO7/c1-20(38)37-32(23-7-6-8-24(19-23)33(34,35)36)31(25(39)13-9-21-11-15-27(41-2)29(17-21)43-4)26(40)14-10-22-12-16-28(42-3)30(18-22)44-5/h6-19,31-32H,1-5H3,(H,37,38) |
| InChIKey | WLIQJTGONACYFB-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.61 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|