C32H32FNO7 — CID 71535344
N-[(E)-5-(3,4-dimethoxyphenyl)-2-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-1-(2-fluorophenyl)-3-oxopent-4-enyl]acetamide (PubChem CID 71535344) has the molecular formula C32H32FNO7 and a molecular weight of 561.61 g/mol. Its IUPAC name is N-[(E)-5-(3,4-dimethoxyphenyl)-2-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-1-(2-fluorophenyl)-3-oxopent-4-enyl]acetamide.
| Compound Name | N-[(E)-5-(3,4-dimethoxyphenyl)-2-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-1-(2-fluorophenyl)-3-oxopent-4-enyl]acetamide |
|---|---|
| PubChem CID | 71535344 |
| Molecular Formula | C32H32FNO7 |
| Molecular Weight | 561.61 g/mol |
| Exact Mass | 561.22 |
| IUPAC Name | N-[(E)-5-(3,4-dimethoxyphenyl)-2-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-1-(2-fluorophenyl)-3-oxopent-4-enyl]acetamide |
| SMILES | COc1ccc(/C=C/C(=O)C(C(=O)/C=C/c2ccc(OC)c(OC)c2)C(NC(C)=O)c2ccccc2F)cc1OC |
| InChI | InChI=1S/C32H32FNO7/c1-20(35)34-32(23-8-6-7-9-24(23)33)31(25(36)14-10-21-12-16-27(38-2)29(18-21)40-4)26(37)15-11-22-13-17-28(39-3)30(19-22)41-5/h6-19,31-32H,1-5H3,(H,34,35)/b14-10+,15-11+ |
| InChIKey | RPXZJJYMVRSTEN-WFYKWJGLSA-N |
| XLogP | 5.22 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.61 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|