C15H18O5 — CID 78108747
2,3,8,10-tetrahydroxy-6-methyl-2,3,4,4a,9a,10-hexahydro-1H-anthracen-9-one (PubChem CID 78108747) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is 2,3,8,10-tetrahydroxy-6-methyl-2,3,4,4a,9a,10-hexahydro-1H-anthracen-9-one.
| Compound Name | 2,3,8,10-tetrahydroxy-6-methyl-2,3,4,4a,9a,10-hexahydro-1H-anthracen-9-one |
|---|---|
| PubChem CID | 78108747 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2,3,8,10-tetrahydroxy-6-methyl-2,3,4,4a,9a,10-hexahydro-1H-anthracen-9-one |
| SMILES | Cc1cc(O)c2c(c1)C(O)C1CC(O)C(O)CC1C2=O |
| InChI | InChI=1S/C15H18O5/c1-6-2-9-13(12(18)3-6)15(20)8-5-11(17)10(16)4-7(8)14(9)19/h2-3,7-8,10-11,14,16-19H,4-5H2,1H3 |
| InChIKey | XNERQQPKUBHQGD-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |