C27H24O4 — CID 11338894
1,8-dihydroxy-3,10-dimethyl-12-propan-2-yl-12,13-dihydronaphtho[1,2-b]phenanthrene-5,6-dione (PubChem CID 11338894) has the molecular formula C27H24O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is 1,8-dihydroxy-3,10-dimethyl-12-propan-2-yl-12,13-dihydronaphtho[1,2-b]phenanthrene-5,6-dione.
| Compound Name | 1,8-dihydroxy-3,10-dimethyl-12-propan-2-yl-12,13-dihydronaphtho[1,2-b]phenanthrene-5,6-dione |
|---|---|
| PubChem CID | 11338894 |
| Molecular Formula | C27H24O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 1,8-dihydroxy-3,10-dimethyl-12-propan-2-yl-12,13-dihydronaphtho[1,2-b]phenanthrene-5,6-dione |
| SMILES | Cc1cc(O)c2c(c1)C(=O)C(=O)c1cc3c(cc1-2)CC(C(C)C)c1cc(C)cc(O)c1-3 |
| InChI | InChI=1S/C27H24O4/c1-12(2)16-9-15-10-19-20(11-17(15)24-18(16)5-13(3)7-22(24)28)26(30)27(31)21-6-14(4)8-23(29)25(19)21/h5-8,10-12,16,28-29H,9H2,1-4H3 |
| InChIKey | KJKATCCXLQTBMC-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|