C30H32O4 — CID 10321835
1,6,8-trihydroxy-3,10-dimethyl-6,12-di(propan-2-yl)-12,13-dihydronaphtho[1,2-b]phenanthren-5-one (PubChem CID 10321835) has the molecular formula C30H32O4 and a molecular weight of 456.58 g/mol. Its IUPAC name is 1,6,8-trihydroxy-3,10-dimethyl-6,12-di(propan-2-yl)-12,13-dihydronaphtho[1,2-b]phenanthren-5-one.
| Compound Name | 1,6,8-trihydroxy-3,10-dimethyl-6,12-di(propan-2-yl)-12,13-dihydronaphtho[1,2-b]phenanthren-5-one |
|---|---|
| PubChem CID | 10321835 |
| Molecular Formula | C30H32O4 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 1,6,8-trihydroxy-3,10-dimethyl-6,12-di(propan-2-yl)-12,13-dihydronaphtho[1,2-b]phenanthren-5-one |
| SMILES | Cc1cc(O)c2c(c1)C(=O)C(O)(C(C)C)c1cc3c(cc1-2)CC(C(C)C)c1cc(C)cc(O)c1-3 |
| InChI | InChI=1S/C30H32O4/c1-14(2)19-11-18-12-22-24(13-20(18)27-21(19)7-16(5)9-25(27)31)30(34,15(3)4)29(33)23-8-17(6)10-26(32)28(22)23/h7-10,12-15,19,31-32,34H,11H2,1-6H3 |
| InChIKey | ONXOMXVQNMEKRS-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |