C16H14Cl2O5 — CID 100994921
(4S,4aS,9aR)-4a,9a-dichloro-8-hydroxy-4-methoxy-6-methyl-3,4-dihydro-1H-anthracene-2,9,10-trione (PubChem CID 100994921) has the molecular formula C16H14Cl2O5 and a molecular weight of 357.19 g/mol. Its IUPAC name is (4S,4aS,9aR)-4a,9a-dichloro-8-hydroxy-4-methoxy-6-methyl-3,4-dihydro-1H-anthracene-2,9,10-trione.
| Compound Name | (4S,4aS,9aR)-4a,9a-dichloro-8-hydroxy-4-methoxy-6-methyl-3,4-dihydro-1H-anthracene-2,9,10-trione |
|---|---|
| PubChem CID | 100994921 |
| Molecular Formula | C16H14Cl2O5 |
| Molecular Weight | 357.19 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | (4S,4aS,9aR)-4a,9a-dichloro-8-hydroxy-4-methoxy-6-methyl-3,4-dihydro-1H-anthracene-2,9,10-trione |
| SMILES | CO[C@H]1CC(=O)C[C@@]2(Cl)C(=O)c3c(O)cc(C)cc3C(=O)[C@@]12Cl |
| InChI | InChI=1S/C16H14Cl2O5/c1-7-3-9-12(10(20)4-7)14(22)15(17)6-8(19)5-11(23-2)16(15,18)13(9)21/h3-4,11,20H,5-6H2,1-2H3/t11-,15+,16-/m0/s1 |
| InChIKey | GUFYJEDLULLKRX-XZJROXQQSA-N |
| XLogP | 2.41 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.19 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|