C15H8Br2O5 — CID 10251951
1,3-dibromo-2,4,5-trihydroxy-7-methylanthracene-9,10-dione (PubChem CID 10251951) has the molecular formula C15H8Br2O5 and a molecular weight of 428.03 g/mol. Its IUPAC name is 1,3-dibromo-2,4,5-trihydroxy-7-methylanthracene-9,10-dione.
| Compound Name | 1,3-dibromo-2,4,5-trihydroxy-7-methylanthracene-9,10-dione |
|---|---|
| PubChem CID | 10251951 |
| Molecular Formula | C15H8Br2O5 |
| Molecular Weight | 428.03 g/mol |
| Exact Mass | 425.87 |
| IUPAC Name | 1,3-dibromo-2,4,5-trihydroxy-7-methylanthracene-9,10-dione |
| SMILES | Cc1cc(O)c2c(c1)C(=O)c1c(Br)c(O)c(Br)c(O)c1C2=O |
| InChI | InChI=1S/C15H8Br2O5/c1-4-2-5-7(6(18)3-4)13(20)9-8(12(5)19)10(16)15(22)11(17)14(9)21/h2-3,18,21-22H,1H3 |
| InChIKey | GPTMXAZKVCUZCW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.03 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|