C22H21NO5 — CID 10199708
1,8-dihydroxy-2,6-dimethyl-4-(2-nitrophenyl)-4,4a,9a,10-tetrahydro-1H-anthracen-9-one (PubChem CID 10199708) has the molecular formula C22H21NO5 and a molecular weight of 379.41 g/mol. Its IUPAC name is 1,8-dihydroxy-2,6-dimethyl-4-(2-nitrophenyl)-4,4a,9a,10-tetrahydro-1H-anthracen-9-one.
| Compound Name | 1,8-dihydroxy-2,6-dimethyl-4-(2-nitrophenyl)-4,4a,9a,10-tetrahydro-1H-anthracen-9-one |
|---|---|
| PubChem CID | 10199708 |
| Molecular Formula | C22H21NO5 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 1,8-dihydroxy-2,6-dimethyl-4-(2-nitrophenyl)-4,4a,9a,10-tetrahydro-1H-anthracen-9-one |
| SMILES | CC1=CC(c2ccccc2[N+](=O)[O-])C2Cc3cc(C)cc(O)c3C(=O)C2C1O |
| InChI | InChI=1S/C22H21NO5/c1-11-7-13-10-16-15(14-5-3-4-6-17(14)23(27)28)9-12(2)21(25)20(16)22(26)19(13)18(24)8-11/h3-9,15-16,20-21,24-25H,10H2,1-2H3 |
| InChIKey | WSFDILGQHWXUDZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|