C26H20F3N3O3 — CID 78111196
3-phenyl-N-[1-phenyl-2-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenoxy]ethyl]prop-2-enamide (PubChem CID 78111196) has the molecular formula C26H20F3N3O3 and a molecular weight of 479.46 g/mol. Its IUPAC name is 3-phenyl-N-[1-phenyl-2-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenoxy]ethyl]prop-2-enamide.
| Compound Name | 3-phenyl-N-[1-phenyl-2-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenoxy]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 78111196 |
| Molecular Formula | C26H20F3N3O3 |
| Molecular Weight | 479.46 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | 3-phenyl-N-[1-phenyl-2-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenoxy]ethyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccccc1)NC(COc1ccc(-c2noc(C(F)(F)F)n2)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H20F3N3O3/c27-26(28,29)25-31-24(32-35-25)20-12-14-21(15-13-20)34-17-22(19-9-5-2-6-10-19)30-23(33)16-11-18-7-3-1-4-8-18/h1-16,22H,17H2,(H,30,33) |
| InChIKey | JADPCCKCVFPWPF-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.46 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|