C25H24N2O3S — CID 87641551
(E)-N-[(2R)-1-[4-(hydroxycarbamothioyl)phenoxy]-3-phenylpropan-2-yl]-3-phenylprop-2-enamide (PubChem CID 87641551) has the molecular formula C25H24N2O3S and a molecular weight of 432.55 g/mol. Its IUPAC name is (E)-N-[(2R)-1-[4-(hydroxycarbamothioyl)phenoxy]-3-phenylpropan-2-yl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[(2R)-1-[4-(hydroxycarbamothioyl)phenoxy]-3-phenylpropan-2-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 87641551 |
| Molecular Formula | C25H24N2O3S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | (E)-N-[(2R)-1-[4-(hydroxycarbamothioyl)phenoxy]-3-phenylpropan-2-yl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)N[C@@H](COc1ccc(C(=S)NO)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C25H24N2O3S/c28-24(16-11-19-7-3-1-4-8-19)26-22(17-20-9-5-2-6-10-20)18-30-23-14-12-21(13-15-23)25(31)27-29/h1-16,22,29H,17-18H2,(H,26,28)(H,27,31)/b16-11+/t22-/m1/s1 |
| InChIKey | ZXNJZZJECTXABN-UPMCQBDUSA-N |
| XLogP | 4.16 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|