C21H24N2O6S — CID 87108509
N-hydroxy-4-[4-methylsulfonyl-2-[[(E)-3-phenylprop-2-enoyl]amino]butoxy]benzamide (PubChem CID 87108509) has the molecular formula C21H24N2O6S and a molecular weight of 432.50 g/mol. Its IUPAC name is N-hydroxy-4-[4-methylsulfonyl-2-[[(E)-3-phenylprop-2-enoyl]amino]butoxy]benzamide.
| Compound Name | N-hydroxy-4-[4-methylsulfonyl-2-[[(E)-3-phenylprop-2-enoyl]amino]butoxy]benzamide |
|---|---|
| PubChem CID | 87108509 |
| Molecular Formula | C21H24N2O6S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | N-hydroxy-4-[4-methylsulfonyl-2-[[(E)-3-phenylprop-2-enoyl]amino]butoxy]benzamide |
| SMILES | CS(=O)(=O)CCC(COc1ccc(C(=O)NO)cc1)NC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C21H24N2O6S/c1-30(27,28)14-13-18(22-20(24)12-7-16-5-3-2-4-6-16)15-29-19-10-8-17(9-11-19)21(25)23-26/h2-12,18,26H,13-15H2,1H3,(H,22,24)(H,23,25)/b12-7+ |
| InChIKey | INUZJPRBDCQIBC-KPKJPENVSA-N |
| XLogP | 1.82 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|