C20H22N2O5 — CID 87108348
N-hydroxy-4-[2-[2-hydroxyethyl-[(E)-3-phenylprop-2-enoyl]amino]ethoxy]benzamide (PubChem CID 87108348) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is N-hydroxy-4-[2-[2-hydroxyethyl-[(E)-3-phenylprop-2-enoyl]amino]ethoxy]benzamide.
| Compound Name | N-hydroxy-4-[2-[2-hydroxyethyl-[(E)-3-phenylprop-2-enoyl]amino]ethoxy]benzamide |
|---|---|
| PubChem CID | 87108348 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | N-hydroxy-4-[2-[2-hydroxyethyl-[(E)-3-phenylprop-2-enoyl]amino]ethoxy]benzamide |
| SMILES | O=C(NO)c1ccc(OCCN(CCO)C(=O)/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C20H22N2O5/c23-14-12-22(19(24)11-6-16-4-2-1-3-5-16)13-15-27-18-9-7-17(8-10-18)20(25)21-26/h1-11,23,26H,12-15H2,(H,21,25)/b11-6+ |
| InChIKey | WSCYIBJATIBFJL-IZZDOVSWSA-N |
| XLogP | 1.72 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|