C20H24N2O4S — CID 8617546
4-(3-methylbutoxy)-N'-[(E)-2-phenylethenyl]sulfonylbenzohydrazide (PubChem CID 8617546) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is 4-(3-methylbutoxy)-N'-[(E)-2-phenylethenyl]sulfonylbenzohydrazide.
| Compound Name | 4-(3-methylbutoxy)-N'-[(E)-2-phenylethenyl]sulfonylbenzohydrazide |
|---|---|
| PubChem CID | 8617546 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 4-(3-methylbutoxy)-N'-[(E)-2-phenylethenyl]sulfonylbenzohydrazide |
| SMILES | CC(C)CCOc1ccc(C(=O)NNS(=O)(=O)/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C20H24N2O4S/c1-16(2)12-14-26-19-10-8-18(9-11-19)20(23)21-22-27(24,25)15-13-17-6-4-3-5-7-17/h3-11,13,15-16,22H,12,14H2,1-2H3,(H,21,23)/b15-13+ |
| InChIKey | SENHBNVISQKXPM-FYWRMAATSA-N |
| XLogP | 3.35 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|