About 4-(phenoxymethyl)-N'-[(E)-2-phenylethenyl]sulfonylbenzohydrazide
4-(phenoxymethyl)-N'-[(E)-2-phenylethenyl]sulfonylbenzohydrazide (PubChem CID 8504810) has the molecular formula C22H20N2O4S
and a molecular weight of 408.48 g/mol. Its IUPAC name is 4-(phenoxymethyl)-N'-[(E)-2-phenylethenyl]sulfonylbenzohydrazide.
Molecular Properties
| Compound Name | 4-(phenoxymethyl)-N'-[(E)-2-phenylethenyl]sulfonylbenzohydrazide |
| PubChem CID | 8504810 |
| Molecular Formula | C22H20N2O4S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 4-(phenoxymethyl)-N'-[(E)-2-phenylethenyl]sulfonylbenzohydrazide |
| SMILES | O=C(NNS(=O)(=O)/C=C/c1ccccc1)c1ccc(COc2ccccc2)cc1 |
| InChI | InChI=1S/C22H20N2O4S/c25-22(23-24-29(26,27)16-15-18-7-3-1-4-8-18)20-13-11-19(12-14-20)17-28-21-9-5-2-6-10-21/h1-16,24H,17H2,(H,23,25)/b16-15+ |
| InChIKey | SEBBYEDPCANRPP-FOCLMDBBSA-N |
| XLogP | 3.50 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(phenoxymethyl)-N'-[(E)-2-phenylethenyl]sulfonylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(phenoxymethyl)-N'-[(E)-2-phenylethenyl]sulfonylbenzohydrazide?
The IUPAC name of 4-(phenoxymethyl)-N'-[(E)-2-phenylethenyl]sulfonylbenzohydrazide (CID 8504810) is 4-(phenoxymethyl)-N'-[(E)-2-phenylethenyl]sulfonylbenzohydrazide.
What is the SMILES notation for 4-(phenoxymethyl)-N'-[(E)-2-phenylethenyl]sulfonylbenzohydrazide?
The canonical SMILES for 4-(phenoxymethyl)-N'-[(E)-2-phenylethenyl]sulfonylbenzohydrazide is O=C(NNS(=O)(=O)/C=C/c1ccccc1)c1ccc(COc2ccccc2)cc1.
What is the InChIKey of 4-(phenoxymethyl)-N'-[(E)-2-phenylethenyl]sulfonylbenzohydrazide?
The InChIKey is SEBBYEDPCANRPP-FOCLMDBBSA-N. The full InChI is InChI=1S/C22H20N2O4S/c25-22(23-24-29(26,27)16-15-18-7-3-1-4-8-18)20-13-11-19(12-14-20)17-28-21-9-5-2-6-10-21/h1-16,24H,17H2,(H,23,25)/b16-15+.
What are the key properties of 4-(phenoxymethyl)-N'-[(E)-2-phenylethenyl]sulfonylbenzohydrazide?
4-(phenoxymethyl)-N'-[(E)-2-phenylethenyl]sulfonylbenzohydrazide has a molecular weight of 408.48 g/mol, XLogP of 3.50, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(phenoxymethyl)-N'-[(E)-2-phenylethenyl]sulfonylbenzohydrazide is sourced from PubChem (CID 8504810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).