C20H18N2O2S — CID 87640979
N-[(2S)-4-[4-(hydroxycarbamothioyl)phenyl]but-3-yn-2-yl]-3-phenylprop-2-enamide (PubChem CID 87640979) has the molecular formula C20H18N2O2S and a molecular weight of 350.44 g/mol. Its IUPAC name is N-[(2S)-4-[4-(hydroxycarbamothioyl)phenyl]but-3-yn-2-yl]-3-phenylprop-2-enamide.
| Compound Name | N-[(2S)-4-[4-(hydroxycarbamothioyl)phenyl]but-3-yn-2-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 87640979 |
| Molecular Formula | C20H18N2O2S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | N-[(2S)-4-[4-(hydroxycarbamothioyl)phenyl]but-3-yn-2-yl]-3-phenylprop-2-enamide |
| SMILES | C[C@@H](C#Cc1ccc(C(=S)NO)cc1)NC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C20H18N2O2S/c1-15(21-19(23)14-11-16-5-3-2-4-6-16)7-8-17-9-12-18(13-10-17)20(25)22-24/h2-6,9-15,24H,1H3,(H,21,23)(H,22,25)/t15-/m0/s1 |
| InChIKey | QFDJRFCBVJCKKR-HNNXBMFYSA-N |
| XLogP | 2.91 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|