C21H20Br2O4 — CID 78112026
1',1'-dibromo-3'-(3,4,5-trimethoxyphenyl)spiro[3,4-dihydronaphthalene-2,2'-cyclopropane]-1-one (PubChem CID 78112026) has the molecular formula C21H20Br2O4 and a molecular weight of 496.20 g/mol. Its IUPAC name is 1',1'-dibromo-3'-(3,4,5-trimethoxyphenyl)spiro[3,4-dihydronaphthalene-2,2'-cyclopropane]-1-one.
| Compound Name | 1',1'-dibromo-3'-(3,4,5-trimethoxyphenyl)spiro[3,4-dihydronaphthalene-2,2'-cyclopropane]-1-one |
|---|---|
| PubChem CID | 78112026 |
| Molecular Formula | C21H20Br2O4 |
| Molecular Weight | 496.20 g/mol |
| Exact Mass | 493.97 |
| IUPAC Name | 1',1'-dibromo-3'-(3,4,5-trimethoxyphenyl)spiro[3,4-dihydronaphthalene-2,2'-cyclopropane]-1-one |
| SMILES | COc1cc(C2C(Br)(Br)C23CCc2ccccc2C3=O)cc(OC)c1OC |
| InChI | InChI=1S/C21H20Br2O4/c1-25-15-10-13(11-16(26-2)17(15)27-3)18-20(21(18,22)23)9-8-12-6-4-5-7-14(12)19(20)24/h4-7,10-11,18H,8-9H2,1-3H3 |
| InChIKey | LYMWXUIHCPGQAN-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.20 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|