C30H48O3 — CID 78114900
8a-(hydroxymethyl)-4,4a,6a,6b,11,11,14a-heptamethyl-1,2,4,5,6,6a,7,8,9,10,12,12a,14,14b-tetradecahydropicene-3,13-dione (PubChem CID 78114900) has the molecular formula C30H48O3 and a molecular weight of 456.71 g/mol. Its IUPAC name is 8a-(hydroxymethyl)-4,4a,6a,6b,11,11,14a-heptamethyl-1,2,4,5,6,6a,7,8,9,10,12,12a,14,14b-tetradecahydropicene-3,13-dione.
| Compound Name | 8a-(hydroxymethyl)-4,4a,6a,6b,11,11,14a-heptamethyl-1,2,4,5,6,6a,7,8,9,10,12,12a,14,14b-tetradecahydropicene-3,13-dione |
|---|---|
| PubChem CID | 78114900 |
| Molecular Formula | C30H48O3 |
| Molecular Weight | 456.71 g/mol |
| Exact Mass | 456.36 |
| IUPAC Name | 8a-(hydroxymethyl)-4,4a,6a,6b,11,11,14a-heptamethyl-1,2,4,5,6,6a,7,8,9,10,12,12a,14,14b-tetradecahydropicene-3,13-dione |
| SMILES | CC1C(=O)CCC2C1(C)CCC1C2(C)CC(=O)C2(C)C3CC(C)(C)CCC3(CO)CCC12C |
| InChI | InChI=1S/C30H48O3/c1-19-20(32)8-9-21-26(19,4)11-10-22-27(21,5)17-24(33)29(7)23-16-25(2,3)12-14-30(23,18-31)15-13-28(22,29)6/h19,21-23,31H,8-18H2,1-7H3 |
| InChIKey | LARNSLRBVBAUAE-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.71 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |