C24H29ClN2O4S2 — CID 78140199
3-[4-[3-(diethylamino)propoxy]phenyl]-5-[(4-hydroxy-3-methoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one;hydrochloride (PubChem CID 78140199) has the molecular formula C24H29ClN2O4S2 and a molecular weight of 509.09 g/mol. Its IUPAC name is 3-[4-[3-(diethylamino)propoxy]phenyl]-5-[(4-hydroxy-3-methoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one;hydrochloride.
| Compound Name | 3-[4-[3-(diethylamino)propoxy]phenyl]-5-[(4-hydroxy-3-methoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one;hydrochloride |
|---|---|
| PubChem CID | 78140199 |
| Molecular Formula | C24H29ClN2O4S2 |
| Molecular Weight | 509.09 g/mol |
| Exact Mass | 508.13 |
| IUPAC Name | 3-[4-[3-(diethylamino)propoxy]phenyl]-5-[(4-hydroxy-3-methoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one;hydrochloride |
| SMILES | CCN(CC)CCCOc1ccc(N2C(=O)C(=Cc3ccc(O)c(OC)c3)SC2=S)cc1.Cl |
| InChI | InChI=1S/C24H28N2O4S2.ClH/c1-4-25(5-2)13-6-14-30-19-10-8-18(9-11-19)26-23(28)22(32-24(26)31)16-17-7-12-20(27)21(15-17)29-3;/h7-12,15-16,27H,4-6,13-14H2,1-3H3;1H |
| InChIKey | QXFLGEGIYZVVDP-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.09 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|