C23H27ClN2O3S2 — CID 71655882
(5Z)-5-[[4-[3-(diethylamino)propoxy]phenyl]methylidene]-3-(4-hydroxyphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one;hydrochloride (PubChem CID 71655882) has the molecular formula C23H27ClN2O3S2 and a molecular weight of 479.07 g/mol. Its IUPAC name is (5Z)-5-[[4-[3-(diethylamino)propoxy]phenyl]methylidene]-3-(4-hydroxyphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one;hydrochloride.
| Compound Name | (5Z)-5-[[4-[3-(diethylamino)propoxy]phenyl]methylidene]-3-(4-hydroxyphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one;hydrochloride |
|---|---|
| PubChem CID | 71655882 |
| Molecular Formula | C23H27ClN2O3S2 |
| Molecular Weight | 479.07 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | (5Z)-5-[[4-[3-(diethylamino)propoxy]phenyl]methylidene]-3-(4-hydroxyphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one;hydrochloride |
| SMILES | CCN(CC)CCCOc1ccc(/C=C2\SC(=S)N(c3ccc(O)cc3)C2=O)cc1.Cl |
| InChI | InChI=1S/C23H26N2O3S2.ClH/c1-3-24(4-2)14-5-15-28-20-12-6-17(7-13-20)16-21-22(27)25(23(29)30-21)18-8-10-19(26)11-9-18;/h6-13,16,26H,3-5,14-15H2,1-2H3;1H/b21-16-; |
| InChIKey | NQTADJMVLGXMRX-PLMZOXRSSA-N |
| XLogP | 5.33 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.07 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|