C29H30ClN3O4S2 — CID 78140146
3-[4-[[3-[4-[2-(diethylamino)ethoxy]phenyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]benzamide;hydrochloride (PubChem CID 78140146) has the molecular formula C29H30ClN3O4S2 and a molecular weight of 584.16 g/mol. Its IUPAC name is 3-[4-[[3-[4-[2-(diethylamino)ethoxy]phenyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]benzamide;hydrochloride.
| Compound Name | 3-[4-[[3-[4-[2-(diethylamino)ethoxy]phenyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]benzamide;hydrochloride |
|---|---|
| PubChem CID | 78140146 |
| Molecular Formula | C29H30ClN3O4S2 |
| Molecular Weight | 584.16 g/mol |
| Exact Mass | 583.14 |
| IUPAC Name | 3-[4-[[3-[4-[2-(diethylamino)ethoxy]phenyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]benzamide;hydrochloride |
| SMILES | CCN(CC)CCOc1ccc(N2C(=O)C(=Cc3ccc(Oc4cccc(C(N)=O)c4)cc3)SC2=S)cc1.Cl |
| InChI | InChI=1S/C29H29N3O4S2.ClH/c1-3-31(4-2)16-17-35-23-14-10-22(11-15-23)32-28(34)26(38-29(32)37)18-20-8-12-24(13-9-20)36-25-7-5-6-21(19-25)27(30)33;/h5-15,18-19H,3-4,16-17H2,1-2H3,(H2,30,33);1H |
| InChIKey | WPRUDRHMVHNNAB-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.16 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|