C31H32N4O4S2 — CID 70697173
3-[4-[(Z)-[3-[4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]benzamide (PubChem CID 70697173) has the molecular formula C31H32N4O4S2 and a molecular weight of 588.76 g/mol. Its IUPAC name is 3-[4-[(Z)-[3-[4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]benzamide.
| Compound Name | 3-[4-[(Z)-[3-[4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]benzamide |
|---|---|
| PubChem CID | 70697173 |
| Molecular Formula | C31H32N4O4S2 |
| Molecular Weight | 588.76 g/mol |
| Exact Mass | 588.19 |
| IUPAC Name | 3-[4-[(Z)-[3-[4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]benzamide |
| SMILES | CN1CCN(CCCOc2ccc(N3C(=O)/C(=C/c4ccc(Oc5cccc(C(N)=O)c5)cc4)SC3=S)cc2)CC1 |
| InChI | InChI=1S/C31H32N4O4S2/c1-33-15-17-34(18-16-33)14-3-19-38-25-12-8-24(9-13-25)35-30(37)28(41-31(35)40)20-22-6-10-26(11-7-22)39-27-5-2-4-23(21-27)29(32)36/h2,4-13,20-21H,3,14-19H2,1H3,(H2,32,36)/b28-20- |
| InChIKey | CDSCWARZCDEAKD-RRAHZORUSA-N |
| XLogP | 5.00 |
| TPSA | 88.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.76 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|