C32H34FN3O4S — CID 142712189
5-[[4-(4-fluorophenoxy)phenyl]methylidene]-3-[4-[5-(4-methylpiperazin-1-yl)pentoxy]phenyl]-1,3-thiazolidine-2,4-dione (PubChem CID 142712189) has the molecular formula C32H34FN3O4S and a molecular weight of 575.71 g/mol. Its IUPAC name is 5-[[4-(4-fluorophenoxy)phenyl]methylidene]-3-[4-[5-(4-methylpiperazin-1-yl)pentoxy]phenyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-(4-fluorophenoxy)phenyl]methylidene]-3-[4-[5-(4-methylpiperazin-1-yl)pentoxy]phenyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 142712189 |
| Molecular Formula | C32H34FN3O4S |
| Molecular Weight | 575.71 g/mol |
| Exact Mass | 575.23 |
| IUPAC Name | 5-[[4-(4-fluorophenoxy)phenyl]methylidene]-3-[4-[5-(4-methylpiperazin-1-yl)pentoxy]phenyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CN1CCN(CCCCCOc2ccc(N3C(=O)SC(=Cc4ccc(Oc5ccc(F)cc5)cc4)C3=O)cc2)CC1 |
| InChI | InChI=1S/C32H34FN3O4S/c1-34-18-20-35(21-19-34)17-3-2-4-22-39-27-15-9-26(10-16-27)36-31(37)30(41-32(36)38)23-24-5-11-28(12-6-24)40-29-13-7-25(33)8-14-29/h5-16,23H,2-4,17-22H2,1H3 |
| InChIKey | QAYIEWGYOKUNCC-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.71 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|