C32H35N3O5S3 — CID 78140177
3-[3-[4-(4-methylpiperazin-1-yl)butoxy]phenyl]-5-[[4-(4-methylsulfonylphenoxy)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 78140177) has the molecular formula C32H35N3O5S3 and a molecular weight of 637.85 g/mol. Its IUPAC name is 3-[3-[4-(4-methylpiperazin-1-yl)butoxy]phenyl]-5-[[4-(4-methylsulfonylphenoxy)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-[3-[4-(4-methylpiperazin-1-yl)butoxy]phenyl]-5-[[4-(4-methylsulfonylphenoxy)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 78140177 |
| Molecular Formula | C32H35N3O5S3 |
| Molecular Weight | 637.85 g/mol |
| Exact Mass | 637.17 |
| IUPAC Name | 3-[3-[4-(4-methylpiperazin-1-yl)butoxy]phenyl]-5-[[4-(4-methylsulfonylphenoxy)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CN1CCN(CCCCOc2cccc(N3C(=O)C(=Cc4ccc(Oc5ccc(S(C)(=O)=O)cc5)cc4)SC3=S)c2)CC1 |
| InChI | InChI=1S/C32H35N3O5S3/c1-33-17-19-34(20-18-33)16-3-4-21-39-28-7-5-6-25(23-28)35-31(36)30(42-32(35)41)22-24-8-10-26(11-9-24)40-27-12-14-29(15-13-27)43(2,37)38/h5-15,22-23H,3-4,16-21H2,1-2H3 |
| InChIKey | TUEWUKKMPADBAQ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.85 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|