C30H32Cl3N3O3S2 — CID 142712230
5-[[4-(4-chlorophenoxy)phenyl]methylidene]-3-[4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-2-sulfanylidene-1,3-thiazolidin-4-one;dihydrochloride (PubChem CID 142712230) has the molecular formula C30H32Cl3N3O3S2 and a molecular weight of 653.10 g/mol. Its IUPAC name is 5-[[4-(4-chlorophenoxy)phenyl]methylidene]-3-[4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-2-sulfanylidene-1,3-thiazolidin-4-one;dihydrochloride.
| Compound Name | 5-[[4-(4-chlorophenoxy)phenyl]methylidene]-3-[4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-2-sulfanylidene-1,3-thiazolidin-4-one;dihydrochloride |
|---|---|
| PubChem CID | 142712230 |
| Molecular Formula | C30H32Cl3N3O3S2 |
| Molecular Weight | 653.10 g/mol |
| Exact Mass | 651.10 |
| IUPAC Name | 5-[[4-(4-chlorophenoxy)phenyl]methylidene]-3-[4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-2-sulfanylidene-1,3-thiazolidin-4-one;dihydrochloride |
| SMILES | CN1CCN(CCCOc2ccc(N3C(=O)C(=Cc4ccc(Oc5ccc(Cl)cc5)cc4)SC3=S)cc2)CC1.Cl.Cl |
| InChI | InChI=1S/C30H30ClN3O3S2.2ClH/c1-32-16-18-33(19-17-32)15-2-20-36-25-13-7-24(8-14-25)34-29(35)28(39-30(34)38)21-22-3-9-26(10-4-22)37-27-11-5-23(31)6-12-27;;/h3-14,21H,2,15-20H2,1H3;2*1H |
| InChIKey | YUEHIFTXQAVYPE-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.10 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|