C31H35Cl2N3O5S3 — CID 78140278
3-[4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-5-[[4-(4-methylsulfonylphenoxy)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one;dihydrochloride (PubChem CID 78140278) has the molecular formula C31H35Cl2N3O5S3 and a molecular weight of 696.74 g/mol. Its IUPAC name is 3-[4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-5-[[4-(4-methylsulfonylphenoxy)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one;dihydrochloride.
| Compound Name | 3-[4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-5-[[4-(4-methylsulfonylphenoxy)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one;dihydrochloride |
|---|---|
| PubChem CID | 78140278 |
| Molecular Formula | C31H35Cl2N3O5S3 |
| Molecular Weight | 696.74 g/mol |
| Exact Mass | 695.11 |
| IUPAC Name | 3-[4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-5-[[4-(4-methylsulfonylphenoxy)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one;dihydrochloride |
| SMILES | CN1CCN(CCCOc2ccc(N3C(=O)C(=Cc4ccc(Oc5ccc(S(C)(=O)=O)cc5)cc4)SC3=S)cc2)CC1.Cl.Cl |
| InChI | InChI=1S/C31H33N3O5S3.2ClH/c1-32-17-19-33(20-18-32)16-3-21-38-25-10-6-24(7-11-25)34-30(35)29(41-31(34)40)22-23-4-8-26(9-5-23)39-27-12-14-28(15-13-27)42(2,36)37;;/h4-15,22H,3,16-21H2,1-2H3;2*1H |
| InChIKey | JSNBSZBLGPPJQM-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.74 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|