C32H35Cl2N3O2S2 — CID 78140257
5-(3,3-diphenylprop-2-enylidene)-3-[4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-2-sulfanylidene-1,3-thiazolidin-4-one;dihydrochloride (PubChem CID 78140257) has the molecular formula C32H35Cl2N3O2S2 and a molecular weight of 628.69 g/mol. Its IUPAC name is 5-(3,3-diphenylprop-2-enylidene)-3-[4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-2-sulfanylidene-1,3-thiazolidin-4-one;dihydrochloride.
| Compound Name | 5-(3,3-diphenylprop-2-enylidene)-3-[4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-2-sulfanylidene-1,3-thiazolidin-4-one;dihydrochloride |
|---|---|
| PubChem CID | 78140257 |
| Molecular Formula | C32H35Cl2N3O2S2 |
| Molecular Weight | 628.69 g/mol |
| Exact Mass | 627.15 |
| IUPAC Name | 5-(3,3-diphenylprop-2-enylidene)-3-[4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-2-sulfanylidene-1,3-thiazolidin-4-one;dihydrochloride |
| SMILES | CN1CCN(CCCOc2ccc(N3C(=O)C(=CC=C(c4ccccc4)c4ccccc4)SC3=S)cc2)CC1.Cl.Cl |
| InChI | InChI=1S/C32H33N3O2S2.2ClH/c1-33-20-22-34(23-21-33)19-8-24-37-28-15-13-27(14-16-28)35-31(36)30(39-32(35)38)18-17-29(25-9-4-2-5-10-25)26-11-6-3-7-12-26;;/h2-7,9-18H,8,19-24H2,1H3;2*1H |
| InChIKey | SBIOCCKQZSBEEV-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.69 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|