C31H30N2O3S2 — CID 71655981
(5Z)-5-(3,3-diphenylprop-2-enylidene)-3-[4-(3-morpholin-4-ylpropoxy)phenyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 71655981) has the molecular formula C31H30N2O3S2 and a molecular weight of 542.73 g/mol. Its IUPAC name is (5Z)-5-(3,3-diphenylprop-2-enylidene)-3-[4-(3-morpholin-4-ylpropoxy)phenyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-(3,3-diphenylprop-2-enylidene)-3-[4-(3-morpholin-4-ylpropoxy)phenyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 71655981 |
| Molecular Formula | C31H30N2O3S2 |
| Molecular Weight | 542.73 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | (5Z)-5-(3,3-diphenylprop-2-enylidene)-3-[4-(3-morpholin-4-ylpropoxy)phenyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/C=C(c2ccccc2)c2ccccc2)SC(=S)N1c1ccc(OCCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C31H30N2O3S2/c34-30-29(17-16-28(24-8-3-1-4-9-24)25-10-5-2-6-11-25)38-31(37)33(30)26-12-14-27(15-13-26)36-21-7-18-32-19-22-35-23-20-32/h1-6,8-17H,7,18-23H2/b29-17- |
| InChIKey | QRSORPPVHQKKDC-RHANQZHGSA-N |
| XLogP | 6.17 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.73 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|