C33H36N4O4S2 — CID 70697174
4-[4-[(Z)-[3-[4-[5-(4-methylpiperazin-1-yl)pentoxy]phenyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]benzamide (PubChem CID 70697174) has the molecular formula C33H36N4O4S2 and a molecular weight of 616.81 g/mol. Its IUPAC name is 4-[4-[(Z)-[3-[4-[5-(4-methylpiperazin-1-yl)pentoxy]phenyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]benzamide.
| Compound Name | 4-[4-[(Z)-[3-[4-[5-(4-methylpiperazin-1-yl)pentoxy]phenyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]benzamide |
|---|---|
| PubChem CID | 70697174 |
| Molecular Formula | C33H36N4O4S2 |
| Molecular Weight | 616.81 g/mol |
| Exact Mass | 616.22 |
| IUPAC Name | 4-[4-[(Z)-[3-[4-[5-(4-methylpiperazin-1-yl)pentoxy]phenyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]benzamide |
| SMILES | CN1CCN(CCCCCOc2ccc(N3C(=O)/C(=C/c4ccc(Oc5ccc(C(N)=O)cc5)cc4)SC3=S)cc2)CC1 |
| InChI | InChI=1S/C33H36N4O4S2/c1-35-18-20-36(21-19-35)17-3-2-4-22-40-27-15-9-26(10-16-27)37-32(39)30(43-33(37)42)23-24-5-11-28(12-6-24)41-29-13-7-25(8-14-29)31(34)38/h5-16,23H,2-4,17-22H2,1H3,(H2,34,38)/b30-23- |
| InChIKey | OFPUGBCEJZJYJD-WMMMYUQOSA-N |
| XLogP | 5.78 |
| TPSA | 88.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.81 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|