C31H32ClN3O4 — CID 142712150
3-[[4-(4-chlorophenoxy)phenyl]methylidene]-1-[4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]pyrrolidine-2,5-dione (PubChem CID 142712150) has the molecular formula C31H32ClN3O4 and a molecular weight of 546.07 g/mol. Its IUPAC name is 3-[[4-(4-chlorophenoxy)phenyl]methylidene]-1-[4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]pyrrolidine-2,5-dione.
| Compound Name | 3-[[4-(4-chlorophenoxy)phenyl]methylidene]-1-[4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 142712150 |
| Molecular Formula | C31H32ClN3O4 |
| Molecular Weight | 546.07 g/mol |
| Exact Mass | 545.21 |
| IUPAC Name | 3-[[4-(4-chlorophenoxy)phenyl]methylidene]-1-[4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]pyrrolidine-2,5-dione |
| SMILES | CN1CCN(CCCOc2ccc(N3C(=O)CC(=Cc4ccc(Oc5ccc(Cl)cc5)cc4)C3=O)cc2)CC1 |
| InChI | InChI=1S/C31H32ClN3O4/c1-33-16-18-34(19-17-33)15-2-20-38-27-13-7-26(8-14-27)35-30(36)22-24(31(35)37)21-23-3-9-28(10-4-23)39-29-11-5-25(32)6-12-29/h3-14,21H,2,15-20,22H2,1H3 |
| InChIKey | NAZPNGZDQXNPEB-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.07 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|