C22H24N2O3 — CID 3724923
3-[[4-(dimethylamino)phenyl]methylidene]-1-(4-propoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 3724923) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is 3-[[4-(dimethylamino)phenyl]methylidene]-1-(4-propoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-[[4-(dimethylamino)phenyl]methylidene]-1-(4-propoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 3724923 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 3-[[4-(dimethylamino)phenyl]methylidene]-1-(4-propoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | CCCOc1ccc(N2C(=O)CC(=Cc3ccc(N(C)C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C22H24N2O3/c1-4-13-27-20-11-9-19(10-12-20)24-21(25)15-17(22(24)26)14-16-5-7-18(8-6-16)23(2)3/h5-12,14H,4,13,15H2,1-3H3 |
| InChIKey | DAVHDEVPBYLIHD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|