C20H28N2OS — CID 91034153
3-[[4-(dimethylamino)phenyl]methylidene]-1-heptyl-5-sulfanylidenepyrrolidin-2-one (PubChem CID 91034153) has the molecular formula C20H28N2OS and a molecular weight of 344.52 g/mol. Its IUPAC name is 3-[[4-(dimethylamino)phenyl]methylidene]-1-heptyl-5-sulfanylidenepyrrolidin-2-one.
| Compound Name | 3-[[4-(dimethylamino)phenyl]methylidene]-1-heptyl-5-sulfanylidenepyrrolidin-2-one |
|---|---|
| PubChem CID | 91034153 |
| Molecular Formula | C20H28N2OS |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 3-[[4-(dimethylamino)phenyl]methylidene]-1-heptyl-5-sulfanylidenepyrrolidin-2-one |
| SMILES | CCCCCCCN1C(=O)C(=Cc2ccc(N(C)C)cc2)CC1=S |
| InChI | InChI=1S/C20H28N2OS/c1-4-5-6-7-8-13-22-19(24)15-17(20(22)23)14-16-9-11-18(12-10-16)21(2)3/h9-12,14H,4-8,13,15H2,1-3H3 |
| InChIKey | JAFUZORBRCTZDW-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|