C21H25ClN2O3S2 — CID 71655912
(5Z)-3-[4-[3-(diethylamino)propoxy]phenyl]-5-(furan-3-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one;hydrochloride (PubChem CID 71655912) has the molecular formula C21H25ClN2O3S2 and a molecular weight of 453.03 g/mol. Its IUPAC name is (5Z)-3-[4-[3-(diethylamino)propoxy]phenyl]-5-(furan-3-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one;hydrochloride.
| Compound Name | (5Z)-3-[4-[3-(diethylamino)propoxy]phenyl]-5-(furan-3-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one;hydrochloride |
|---|---|
| PubChem CID | 71655912 |
| Molecular Formula | C21H25ClN2O3S2 |
| Molecular Weight | 453.03 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | (5Z)-3-[4-[3-(diethylamino)propoxy]phenyl]-5-(furan-3-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one;hydrochloride |
| SMILES | CCN(CC)CCCOc1ccc(N2C(=O)/C(=C/c3ccoc3)SC2=S)cc1.Cl |
| InChI | InChI=1S/C21H24N2O3S2.ClH/c1-3-22(4-2)11-5-12-26-18-8-6-17(7-9-18)23-20(24)19(28-21(23)27)14-16-10-13-25-15-16;/h6-10,13-15H,3-5,11-12H2,1-2H3;1H/b19-14-; |
| InChIKey | ZXVPATQVZQAMQF-YEBWQKSTSA-N |
| XLogP | 5.22 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.03 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|