C24H32NO4+ — CID 7814904
[(2S)-2-hydroxy-3-[4-(3-oxobutyl)phenoxy]propyl]-methyl-[(4-prop-2-enoxyphenyl)methyl]azanium (PubChem CID 7814904) has the molecular formula C24H32NO4+ and a molecular weight of 398.52 g/mol. Its IUPAC name is [(2S)-2-hydroxy-3-[4-(3-oxobutyl)phenoxy]propyl]-methyl-[(4-prop-2-enoxyphenyl)methyl]azanium.
| Compound Name | [(2S)-2-hydroxy-3-[4-(3-oxobutyl)phenoxy]propyl]-methyl-[(4-prop-2-enoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 7814904 |
| Molecular Formula | C24H32NO4+ |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | [(2S)-2-hydroxy-3-[4-(3-oxobutyl)phenoxy]propyl]-methyl-[(4-prop-2-enoxyphenyl)methyl]azanium |
| SMILES | C=CCOc1ccc(C[NH+](C)C[C@H](O)COc2ccc(CCC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C24H31NO4/c1-4-15-28-23-13-9-21(10-14-23)16-25(3)17-22(27)18-29-24-11-7-20(8-12-24)6-5-19(2)26/h4,7-14,22,27H,1,5-6,15-18H2,2-3H3/p+1/t22-/m0/s1 |
| InChIKey | AERZPGPMSZKQKX-QFIPXVFZSA-O |
| XLogP | 2.23 |
| TPSA | 60.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|